
| Type: | Organic raw materials/esters/organic acid esters | 
| Product name: | Methyl hydrazinocarboxylate | 
| CAS NO: | 6294-89-9 | 
| Molecular weight: | 90.0812 | 
| EC NO: | 228-560-3 | 
| Molecular formula: | C2H6N2O2 | 
| InChI: | InChI=1/C2H6N2O2/c1-6-2(5)4-3/h3H2,1H3,(H,4,5) | 
| Product description: | Methyl hydrazinocarboxylate Appearance White crystal 99.5 Melting point, ℃ 73-76 Insoluble matter≤0.02% Combustion residue≤0.02% Moisture content≤0.02% PH value of 10% aqueous solution at 25℃ 8.20 Color of 12% aqueous solution≤8 Chloride ion, ppm ≤5 sulfate fluoride ion, ppm ≤5 sulfide ion, ppm ≤20 silicon ion, ppm ≤10 copper ion, ppm ≤1 total heavy metal ion content, ppm ≤10 | 
| Alias: | Carbohydrazide methyl; Methoxycarbazide; Methyl hydrazine formate; Hydrazine methylformate; Methoxycarbonyl hydrazide | 
| Structural formula: | ![]()  |